[3-(chlorosulfonyl)-4-methoxyphenyl]acetic acid(SALTDATA: FREE) structure
|
Common Name | [3-(chlorosulfonyl)-4-methoxyphenyl]acetic acid(SALTDATA: FREE) | ||
|---|---|---|---|---|
| CAS Number | 104967-35-3 | Molecular Weight | 264.68300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9ClO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-chlorosulfonyl-4-methoxyphenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H9ClO5S |
|---|---|
| Molecular Weight | 264.68300 |
| Exact Mass | 263.98600 |
| PSA | 89.05000 |
| LogP | 2.33060 |
| InChIKey | FYIDPDFPNMMBIH-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC(=O)O)cc1S(=O)(=O)Cl |
| HS Code | 2918990090 |
|---|
|
~79%
[3-(chlorosulfo... CAS#:104967-35-3 |
| Literature: Abbott Laboratories Patent: US5158948 A1, 1992 ; US 5158948 A |
|
~%
[3-(chlorosulfo... CAS#:104967-35-3 |
| Literature: Journal of Organic Chemistry, , vol. 5, p. 606,608 |
|
~%
[3-(chlorosulfo... CAS#:104967-35-3 |
| Literature: Journal of Organic Chemistry, , vol. 5, p. 606,608 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-chlorosulfonyl-4-methoxyphenylacetic acid |
| 2-(3-(Chlorosulfonyl)-4-methoxyphenyl)acetic acid |
| (3-Chlorsulfonyl-4-methoxy-phenyl)-essigsaeure |