tert-butyl 3-[(methylamino)methyl]azetidine-1-carboxylate structure
|
Common Name | tert-butyl 3-[(methylamino)methyl]azetidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1049730-81-5 | Molecular Weight | 200.278 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 261.9±13.0 °C at 760 mmHg | |
| Molecular Formula | C10H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 112.2±19.8 °C | |
| Name | tert-butyl 3-(methylaminomethyl)azetidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 261.9±13.0 °C at 760 mmHg |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.278 |
| Flash Point | 112.2±19.8 °C |
| Exact Mass | 200.152481 |
| PSA | 41.57000 |
| LogP | 0.30 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.476 |
| InChIKey | LNDGYTKISRFVOI-UHFFFAOYSA-N |
| SMILES | CNCC1CN(C(=O)OC(C)(C)C)C1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| azetidine-1-carboxylate |
| 1-N-Boc-3-methylaminomethyl-azetidine |