Ro 51 structure
|
Common Name | Ro 51 | ||
|---|---|---|---|---|
| CAS Number | 1050670-85-3 | Molecular Weight | 474.29300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H23IN4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ro 51RO-51 is a potent, selective and drug-like dual P2X3 and P2X2/3 antagonist with pIC50 of 8.7 and 8.3, respectively.. |
| Name | 2-{[4-Amino-5-(5-iodo-2-isopropyl-4-methoxyphenoxy)-2-pyrimidinyl ]amino}-1,3-propanediol |
|---|
| Molecular Formula | C17H23IN4O4 |
|---|---|
| Molecular Weight | 474.29300 |
| Exact Mass | 474.07600 |
| PSA | 123.48000 |
| LogP | 2.35590 |
| InChIKey | PAYROHWFGZADBR-UHFFFAOYSA-N |
| SMILES | COc1cc(C(C)C)c(Oc2cnc(NC(CO)CO)nc2N)cc1I |