Nevirapine-d3 structure
|
Common Name | Nevirapine-d3 | ||
|---|---|---|---|---|
| CAS Number | 1051419-24-9 | Molecular Weight | 269.31600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11D3N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Nevirapine-d3Nevirapine-d3 (BI-RG 587-d3) is the deuterium labeled Nevirapine. Nevirapine is a non-nucleoside inhibitor of HIV-1 reverse transcriptase used to treat and prevent HIV/AIDS; with a Ki of 270 μM[1]. |
| Name | Nevirapine-d3 |
|---|---|
| Synonym | More Synonyms |
| Description | Nevirapine-d3 (BI-RG 587-d3) is the deuterium labeled Nevirapine. Nevirapine is a non-nucleoside inhibitor of HIV-1 reverse transcriptase used to treat and prevent HIV/AIDS; with a Ki of 270 μM[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C15H11D3N4O |
|---|---|
| Molecular Weight | 269.31600 |
| Exact Mass | 269.13600 |
| PSA | 61.61000 |
| LogP | 2.53580 |
| InChIKey | NQDJXKOVJZTUJA-FIBGUPNXSA-N |
| SMILES | Cc1ccnc2c1NC(=O)c1cccnc1N2C1CC1 |
| 11-cyclopropyl-4-(trideuteriomethyl)-5H-dipyrido[2,3-e:2',3'-f][1,4]diazepin-6-one |