Osaterone structure
|
Common Name | Osaterone | ||
|---|---|---|---|---|
| CAS Number | 105149-04-0 | Molecular Weight | 364.86300 | |
| Density | 1.3g/cm3 | Boiling Point | 536.1ºC at 760mmHg | |
| Molecular Formula | C20H25ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.1ºC | |
| Name | (1R,3aS,3bR,9aR,9bS,11aS)-1-acetyl-5-chloro-1-hydroxy-9a,11a-dimethyl-2,3,3a,3b,9,9b,10,11-octahydroindeno[4,5-h]isochromen-7-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 536.1ºC at 760mmHg |
| Molecular Formula | C20H25ClO4 |
| Molecular Weight | 364.86300 |
| Flash Point | 278.1ºC |
| Exact Mass | 364.14400 |
| PSA | 63.60000 |
| LogP | 3.37480 |
| Vapour Pressure | 9.86E-14mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | ZLLOIFNEEWYATC-XMUHMHRVSA-N |
| SMILES | CC(=O)C1(O)CCC2C3C=C(Cl)C4=CC(=O)OCC4(C)C3CCC21C |
|
~65%
Osaterone CAS#:105149-04-0 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 40, # 4 p. 935 - 941 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| Osaterone [INN] |
| 6-chloro-17-hydroxy-2-oxapregna-4,6-diene-3,20-dione |
| 2-oxachlormadinone |
| Osaterone |