[(1R,3R,3aS,3bR,9aR,9bS,11aS)-1-acetyl-5-chloro-3-hydroxy-9a,11a-dimethyl-7-oxo-2,3,3a,3b,9,9b,10,11-octahydroindeno[4,5-h]isochromen-1-yl] acetate structure
|
Common Name | [(1R,3R,3aS,3bR,9aR,9bS,11aS)-1-acetyl-5-chloro-3-hydroxy-9a,11a-dimethyl-7-oxo-2,3,3a,3b,9,9b,10,11-octahydroindeno[4,5-h]isochromen-1-yl] acetate | ||
|---|---|---|---|---|
| CAS Number | 124530-41-2 | Molecular Weight | 422.89900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H27ClO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(1R,3R,3aS,3bR,9aR,9bS,11aS)-1-acetyl-5-chloro-3-hydroxy-9a,11a-dimethyl-7-oxo-2,3,3a,3b,9,9b,10,11-octahydroindeno[4,5-h]isochromen-1-yl] acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H27ClO6 |
|---|---|
| Molecular Weight | 422.89900 |
| Exact Mass | 422.15000 |
| PSA | 89.90000 |
| LogP | 2.91640 |
| InChIKey | PUVIUQNYQQPAQB-LZGXPLDUSA-N |
| SMILES | CC(=O)OC1(C(C)=O)CC(O)C2C3C=C(Cl)C4=CC(=O)OCC4(C)C3CCC21C |
|
~%
[(1R,3R,3aS,3bR... CAS#:124530-41-2 |
| Literature: Takegawa; Koizumi; Takahashi; Shibata Chemical and Pharmaceutical Bulletin, 1993 , vol. 41, # 5 p. 870 - 875 |
|
~%
[(1R,3R,3aS,3bR... CAS#:124530-41-2 |
| Literature: Takegawa; Koizumi; Takahashi; Shibata Chemical and Pharmaceutical Bulletin, 1993 , vol. 41, # 5 p. 870 - 875 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| unii-t1fe32x91z |