2-Acetyl-10-[3-(4-methylpiperazino)propyl]-10H-phenothiazine structure
|
Common Name | 2-Acetyl-10-[3-(4-methylpiperazino)propyl]-10H-phenothiazine | ||
|---|---|---|---|---|
| CAS Number | 1053-74-3 | Molecular Weight | 381.53400 | |
| Density | 1.167g/cm3 | Boiling Point | 554.8ºC at 760mmHg | |
| Molecular Formula | C22H27N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.3ºC | |
| Name | 1-[10-[3-(4-methylpiperazin-1-yl)propyl]phenothiazin-2-yl]ethanone |
|---|
| Density | 1.167g/cm3 |
|---|---|
| Boiling Point | 554.8ºC at 760mmHg |
| Molecular Formula | C22H27N3OS |
| Molecular Weight | 381.53400 |
| Flash Point | 289.3ºC |
| Exact Mass | 381.18700 |
| PSA | 52.09000 |
| LogP | 4.07020 |
| Vapour Pressure | 2.39E-12mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | WKCTYFQBCFYMAR-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc2c(c1)N(CCCN1CCN(C)CC1)c1ccccc1S2 |
| HS Code | 2934300000 |
|---|
|
~%
2-Acetyl-10-[3-... CAS#:1053-74-3 |
| Literature: Schmidt, Matthias; Teitge, Marlen; Castillo, Marianela E.; Brandt, Tobias; Dobner, Bodo; Langner, Andreas Archiv der Pharmazie, 2008 , vol. 341, # 10 p. 624 - 638 |
|
~%
2-Acetyl-10-[3-... CAS#:1053-74-3 |
| Literature: Grisenko,A.N.; Zhuravlev,S.V. J. Gen. Chem. USSR (Engl. Transl.), 1962 , vol. 32, p. 1915 - 1919,1892 - 1895 |
|
~%
2-Acetyl-10-[3-... CAS#:1053-74-3 |
| Literature: Craig,P.N. et al. Journal of Organic Chemistry, 1961 , vol. 26, p. 1138 - 1143 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |