Deoxyursocholic acid methyl ester structure
|
Common Name | Deoxyursocholic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 10538-55-3 | Molecular Weight | 406.59900 | |
| Density | 1.089g/cm3 | Boiling Point | 507.571ºC at 760 mmHg | |
| Molecular Formula | C25H42O4 | Melting Point | 142-143ºC | |
| MSDS | N/A | Flash Point | 162.13ºC | |
| Name | methyl (4R)-4-[(3R,5S,7S,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.089g/cm3 |
|---|---|
| Boiling Point | 507.571ºC at 760 mmHg |
| Melting Point | 142-143ºC |
| Molecular Formula | C25H42O4 |
| Molecular Weight | 406.59900 |
| Flash Point | 162.13ºC |
| Exact Mass | 406.30800 |
| PSA | 66.76000 |
| LogP | 4.56630 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | GRQROVWZGGDYSW-ZQMFMVRBSA-N |
| SMILES | COC(=O)CCC(C)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CCC12C |
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| Methyl Ursodeoxycholate |
| Ursodeoxycholic Acid Methyl Ester |
| methyl ester of ursodeoxycholic acid |
| Methyl 3|A,7|A-Dihydroxy-5|A-cholanoate |
| 3|A,7|A-Dihydroxy-5|A-cholanic Acid Methyl Ester |
| Methyl 3,7-Dihydroxycholan-24-Oate |
| Deoxyursocholic acid methyl ester |