2-oxo-2H-chromene-6-sulfonyl chloride structure
|
Common Name | 2-oxo-2H-chromene-6-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 10543-42-7 | Molecular Weight | 244.65200 | |
| Density | 1.591g/cm3 | Boiling Point | 431.6ºC at 760mmHg | |
| Molecular Formula | C9H5ClO4S | Melting Point | 110-113ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2-oxo-2H-chromene-6-sulfonyl chlorideCoumarin-6-sulfonyl chloride is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | 2-oxochromene-6-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Description | Coumarin-6-sulfonyl chloride is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.591g/cm3 |
|---|---|
| Boiling Point | 431.6ºC at 760mmHg |
| Melting Point | 110-113ºC |
| Molecular Formula | C9H5ClO4S |
| Molecular Weight | 244.65200 |
| Exact Mass | 243.96000 |
| PSA | 72.73000 |
| LogP | 2.80130 |
| Vapour Pressure | 1.19E-07mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | HQIPMBGUDSOVEA-UHFFFAOYSA-N |
| SMILES | O=c1ccc2cc(S(=O)(=O)Cl)ccc2o1 |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3261 |
| WGK Germany | 3 |
| Hazard Class | 8.0 |
| HS Code | 2932209090 |
|
~%
2-oxo-2H-chrome... CAS#:10543-42-7 |
| Literature: Journal of the Indian Chemical Society, , vol. 34, p. 35,36, 39 |
|
~%
2-oxo-2H-chrome... CAS#:10543-42-7 |
| Literature: Journal of the Indian Chemical Society, , vol. 34, p. 35,36, 39 |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Oxo-2H-chromen-6-sulfonylchlorid |
| coumarin-6-sulphonyl chloride |
| Coumarin-6-sulfonyl chloride |
| MFCD01941320 |
| 2-Oxo-2H-chromene-6-sulfonyl chloride |