4-(4-Cyclohexylphenyl)-1,3-thiazol-2-amine structure
|
Common Name | 4-(4-Cyclohexylphenyl)-1,3-thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 105512-86-5 | Molecular Weight | 258.38200 | |
| Density | 1.169g/cm3 | Boiling Point | 442.8ºC at 760 mmHg | |
| Molecular Formula | C15H18N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.6ºC | |
| Name | 4-(4-Cyclohexylphenyl)-1,3-thiazol-2-amine |
|---|
| Density | 1.169g/cm3 |
|---|---|
| Boiling Point | 442.8ºC at 760 mmHg |
| Molecular Formula | C15H18N2S |
| Molecular Weight | 258.38200 |
| Flash Point | 221.6ºC |
| Exact Mass | 258.11900 |
| PSA | 67.15000 |
| LogP | 5.02120 |
| Vapour Pressure | 4.86E-08mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | MWEXZTFCZYULFR-UHFFFAOYSA-N |
| SMILES | Nc1nc(-c2ccc(C3CCCCC3)cc2)cs1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |