4-(4-Bromophenyl)-1,3-thiazol-2-amine structure
|
Common Name | 4-(4-Bromophenyl)-1,3-thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 2103-94-8 | Molecular Weight | 255.134 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 410.9±20.0 °C at 760 mmHg | |
| Molecular Formula | C9H7BrN2S | Melting Point | 183-187 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 202.3±21.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-(4-bromophenyl)-1,3-thiazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 410.9±20.0 °C at 760 mmHg |
| Melting Point | 183-187 °C(lit.) |
| Molecular Formula | C9H7BrN2S |
| Molecular Weight | 255.134 |
| Flash Point | 202.3±21.8 °C |
| Exact Mass | 253.951324 |
| PSA | 67.15000 |
| LogP | 3.04 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.685 |
| InChIKey | ZBRNKOLWXWMLTA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC(=N2)N)Br |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| 2-Amino-4-(4-bromophenyl)thiazole |
| 2-Thiazolamine, 4-(4-bromophenyl)- |
| 4-(4-Bromophenyl)-1,3-thiazol-2-amine |
| MFCD00051953 |