Methanone,2-pyridinyl[1,2,3]triazolo[1,5-a]pyridin-3-yl- structure
|
Common Name | Methanone,2-pyridinyl[1,2,3]triazolo[1,5-a]pyridin-3-yl- | ||
|---|---|---|---|---|
| CAS Number | 10554-49-1 | Molecular Weight | 224.21800 | |
| Density | 1.37g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H8N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | pyridin-2-yl(triazolo[1,5-a]pyridin-3-yl)methanone |
|---|
| Density | 1.37g/cm3 |
|---|---|
| Molecular Formula | C12H8N4O |
| Molecular Weight | 224.21800 |
| Exact Mass | 224.07000 |
| PSA | 60.15000 |
| LogP | 1.35530 |
| Index of Refraction | 1.719 |
| InChIKey | QKGQBNBVZVLUKT-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccn1)c1nnn2ccccc12 |
| HS Code | 2933990090 |
|---|
|
~7%
Methanone,2-pyr... CAS#:10554-49-1 |
| Literature: Abarca, Belen; Ballesteros, Rafael; Chadlaoui, Mimoun Tetrahedron, 2004 , vol. 60, # 27 p. 5785 - 5792 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |