Methyl 3-(p-methoxyphenyl)-2,3-epoxypropionate
Methyl 3-(p-methoxyphenyl)-2,3-epoxypropionate structure
|
Common Name | Methyl 3-(p-methoxyphenyl)-2,3-epoxypropionate | ||
|---|---|---|---|---|
| CAS Number | 105560-93-8 | Molecular Weight | 208.211 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 297.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C11H12O4 | Melting Point | 87-88 °C (lit.) | |
| MSDS | N/A | Flash Point | 129.2±27.4 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl (2r,3s)-2,3-epoxy-3-(4-methoxyphenyl)propionate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 297.7±40.0 °C at 760 mmHg |
| Melting Point | 87-88 °C (lit.) |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.211 |
| Flash Point | 129.2±27.4 °C |
| Exact Mass | 208.073563 |
| PSA | 48.06000 |
| LogP | 1.27 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | CVZUMGUZDAWOGA-NXEZZACHSA-N |
| SMILES | COC(=O)C1OC1c1ccc(OC)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R41 |
| Safety Phrases | S24-S26-S37/39-S61 |
| HS Code | 2918990090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 1 | |
CAS#:96125-49-4
CAS#:71-36-3
CAS#:943-89-5
CAS#:336113-23-6
CAS#:3901-07-3
CAS#:67-56-1
CAS#:136597-65-4
CAS#:19310-29-3
CAS#:42399-40-6This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| methyl 2R,3S-(-)-3-(4-methoxyphenyl)oxiranecarboxylate |
| (2R-trans)-3-[4-Methoxyphenyl]glycidic acid methyl ester |
| (-)-(2R,3S)-2,3-Epoxy-3-(4methoxyphenyl)propronate |
| (2R,3S)-methyl trans-3-(4-methoxyphenyl)glycidate |
| Methyl 3-(4-methoxyphenyl)oxirane-2-carboxylate |
| METHYL (-)-(2R,3S)-2,3-EPOXY-3-(4METHOXYPHENYL)PROPRONATE |
| (2R,3S)-3-(4-Methoxyphenyl)glycidic acid methyl ester |
| methyl (2R,3S)-3-(4-methoxyphenyl)glycidate |
| MFCD06658225 |
| Methyl 3-(4-methoxyphenyl)-2-oxiranecarboxylate |
| (2R,3S) trans-3-(4-methoxyphenyl)-glycidic acid methyl ester |
| Methyl 3-(p-methoxyphenyl)-2,3-epoxypropionate |
| (-)-methyl-3-(4-methoxyphenyl)glycidate |
| METHYL (2R,3S)-2,3-E |
| methyl (2S,3S)-3-(4-methoxyphenyl)oxirane-2-carboxylate |
| EINECS 404-130-2 |
| Methyl (2R,3S)-3-(4-methoxyphenyl)oxirane-2-carboxylate |
| methyl (2R,3S)-3-(p-methoxyphenyl)-glycidate |
| 2-Oxiranecarboxylic acid, 3-(4-methoxyphenyl)-, methyl ester |
| Methyl (2R,3S)-3-(4-methoxyphenyl)-2-oxiranecarboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of methyl (2r,3s)-2,3-epoxy-3-(4-methoxyphenyl)propionate? |
| A: Related downstream products(CAS) of methyl (2r,3s)-2,3-epoxy-3-(4-methoxyphenyl)propionate: 42399-40-6. |
| Q: What are the upstream materials of methyl (2r,3s)-2,3-epoxy-3-(4-methoxyphenyl)propionate? |
| A: Related upstream materials(CAS) of methyl (2r,3s)-2,3-epoxy-3-(4-methoxyphenyl)propionate: 96125-49-4;71-36-3;943-89-5;336113-23-6;3901-07-3;67-56-1;136597-65-4;19310-29-3. |
| Q: What is the SMILES notation of methyl (2r,3s)-2,3-epoxy-3-(4-methoxyphenyl)propionate? |
| A: SMILES notation of methyl (2r,3s)-2,3-epoxy-3-(4-methoxyphenyl)propionate is COC(=O)C1OC1c1ccc(OC)cc1. |
| Q: What is the melting point of methyl (2r,3s)-2,3-epoxy-3-(4-methoxyphenyl)propionate? |
| A: Melting point of methyl (2r,3s)-2,3-epoxy-3-(4-methoxyphenyl)propionate is 87-88 °C (lit.). |
| Q: What is the molecular weight of methyl (2r,3s)-2,3-epoxy-3-(4-methoxyphenyl)propionate? |
| A: Molecular weight of methyl (2r,3s)-2,3-epoxy-3-(4-methoxyphenyl)propionate is 208.211. |
| Q: What is the CAS number of methyl (2r,3s)-2,3-epoxy-3-(4-methoxyphenyl)propionate? |
| A: CAS number of methyl (2r,3s)-2,3-epoxy-3-(4-methoxyphenyl)propionate is 105560-93-8. |
| Q: What is the English name of methyl (2r,3s)-2,3-epoxy-3-(4-methoxyphenyl)propionate? |
| A: The English name of methyl (2r,3s)-2,3-epoxy-3-(4-methoxyphenyl)propionate is methyl (2r,3s)-2,3-epoxy-3-(4-methoxyphenyl)propionate. |
| Q: What is the polar surface area (PSA) of methyl (2r,3s)-2,3-epoxy-3-(4-methoxyphenyl)propionate? |
| A: Polar surface area (PSA) of methyl (2r,3s)-2,3-epoxy-3-(4-methoxyphenyl)propionate is 48.06000. |
| Q: What is the boiling point of methyl (2r,3s)-2,3-epoxy-3-(4-methoxyphenyl)propionate? |
| A: Boiling point of methyl (2r,3s)-2,3-epoxy-3-(4-methoxyphenyl)propionate is 297.7±40.0 °C at 760 mmHg. |
| Q: What is the molecular formula of methyl (2r,3s)-2,3-epoxy-3-(4-methoxyphenyl)propionate? |
| A: Molecular formula of methyl (2r,3s)-2,3-epoxy-3-(4-methoxyphenyl)propionate is C11H12O4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |