1-[4-(trifluoromethyl)phenyl]propane-1,2-dione structure
|
Common Name | 1-[4-(trifluoromethyl)phenyl]propane-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 10557-13-8 | Molecular Weight | 216.15700 | |
| Density | 1.285g/cm3 | Boiling Point | 250.1ºC at 760 mmHg | |
| Molecular Formula | C10H7F3O2 | Melting Point | 30-32ºC | |
| MSDS | N/A | Flash Point | 95.2ºC | |
| Name | 1-[4-(trifluoromethyl)phenyl]propane-1,2-dione |
|---|
| Density | 1.285g/cm3 |
|---|---|
| Boiling Point | 250.1ºC at 760 mmHg |
| Melting Point | 30-32ºC |
| Molecular Formula | C10H7F3O2 |
| Molecular Weight | 216.15700 |
| Flash Point | 95.2ºC |
| Exact Mass | 216.04000 |
| PSA | 34.14000 |
| LogP | 2.47710 |
| Vapour Pressure | 0.022mmHg at 25°C |
| Index of Refraction | 1.458 |
| InChIKey | FAKCECCBNBDCNE-UHFFFAOYSA-N |
| SMILES | CC(=O)C(=O)c1ccc(C(F)(F)F)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2914700090 |
|
~71%
1-[4-(trifluoro... CAS#:10557-13-8 |
| Literature: Journal of Organic Chemistry, , vol. 76, # 16 p. 6958 - 6961 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |