Acetamide,N-(4-nitrophenyl)-N-nitroso- structure
|
Common Name | Acetamide,N-(4-nitrophenyl)-N-nitroso- | ||
|---|---|---|---|---|
| CAS Number | 10557-68-3 | Molecular Weight | 209.15900 | |
| Density | 1.41g/cm3 | Boiling Point | 356.7ºC at 760mmHg | |
| Molecular Formula | C8H7N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.5ºC | |
| Name | N-(4-nitrophenyl)-N-nitrosoacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 356.7ºC at 760mmHg |
| Molecular Formula | C8H7N3O4 |
| Molecular Weight | 209.15900 |
| Flash Point | 169.5ºC |
| Exact Mass | 209.04400 |
| PSA | 95.56000 |
| LogP | 2.15230 |
| Vapour Pressure | 2.87E-05mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | DQWCQNBLVSEOPS-UHFFFAOYSA-N |
| SMILES | CC(=O)N(N=O)c1ccc([N+](=O)[O-])cc1 |
|
~%
Acetamide,N-(4-... CAS#:10557-68-3 |
| Literature: Canadian Journal of Chemistry, , vol. 45, p. 1539 - 1542 |
|
~%
Acetamide,N-(4-... CAS#:10557-68-3 |
| Literature: Journal of the Chemical Society, , p. 369 |
| acetic acid-(4-nitro-N-nitroso-anilide) |
| N-<4-Nitro-phenyl>-N-nitroso-acetamid |
| Essigsaeure-(N-nitroso-4-nitro-anilid) |
| Essigsaeure-(4-nitro-N-nitroso-anilid) |
| N-Acetyl-N-nitroso-4-nitro-anilin |
| N-nitrosamide of N-(4-nitrophenyl)acetamide |
| N-nitroso-p-nitro-acetanilide |