4-Nitroacetanilide structure
|
Common Name | 4-Nitroacetanilide | ||
|---|---|---|---|---|
| CAS Number | 104-04-1 | Molecular Weight | 180.161 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 408.9±28.0 °C at 760 mmHg | |
| Molecular Formula | C8H8N2O3 | Melting Point | 213-215 °C(lit.) | |
| MSDS | USA | Flash Point | 201.1±24.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4'-nitroacetanilide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 408.9±28.0 °C at 760 mmHg |
| Melting Point | 213-215 °C(lit.) |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.161 |
| Flash Point | 201.1±24.0 °C |
| Exact Mass | 180.053497 |
| PSA | 74.92000 |
| LogP | 1.66 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | NQRLPDFELNCFHW-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc([N+](=O)[O-])cc1 |
| Storage condition | 2-8°C |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | AE5075000 |
| HS Code | 2924299090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Improved accuracy in high-temperature conversion elemental analyzer δ18O measurements of nitrogen-rich organics.
Rapid Commun. Mass Spectrom. 26(5) , 554-62, (2012) The use of high-temperature conversion (HTC) reduction systems interfaced with isotope ratio mass spectrometers for δ(18)O measurements of nitrogen-containing organic materials is complicated by isoba... |
|
|
Dinuclear Nickel(II) Complexes as Models for the Active Site of Urease.
Inorg. Chem. 35(13) , 3792-3803, (1996) Dinuclear nickel(II) complexes of the ligands 2,6-bis[bis((2-benzimidazolylmethyl)amino)methyl]-p-cresol (bbapOH), N,N,N',N'-tetrakis(2-benzimidazolylmethyl)-2-hydroxy-1,3-diaminopropane (tbpOH), N-me... |
|
|
Gene cloning and characterization of arylamineN-acetyltransferase fromBacillus cereusstrain 10-L-2
J. Biosci. Bioeng. 107(1) , 27-32, (2009) Bacillus cereus strain 10-L-2 synthesizes two arylamine N-acetyltransferases (Nat-a and Nat-b) with broad substrate specificities toward aniline and its derivatives. In southern blot analysis using pr... |
| Acetanilide, p-nitro- |
| N1-(4-nitrophenyl)acetamide |
| N-Acetyl-p-nitroaniline |
| 4‘-Nitroacetanilide |
| Acetanilide,p-nitro |
| acetic acid p-nitroanilide |
| EINECS 203-169-0 |
| Acetanilide,4'-nitro |
| 4′-Nitroacetanilide |
| 4-NITROACETANILIDE |
| N-(4-Nitrophenyl)acetamide |
| 4-MeCONHC6H4NO2 |
| 4'-Nitroacetanilide |
| N-Ac-4-nitroaniline |
| p-Nitroacetanilide |
| MFCD00007303 |
| N-Acetyl-4-nitroaniline |
| p-acetamino nitrobenzene |
| p-nitro-acetanilid |
| Acetamide, N-(4-nitrophenyl)- |
| Acetanilide, 4'-nitro- |