1,3,5-tri-tert-butylhexahydro-1,3,5-triazine structure
|
Common Name | 1,3,5-tri-tert-butylhexahydro-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 10560-39-1 | Molecular Weight | 255.44300 | |
| Density | 0.917g/cm3 | Boiling Point | 287.5ºC at 760 mmHg | |
| Molecular Formula | C15H33N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 113ºC | |
| Name | 1,3,5-tritert-butyl-1,3,5-triazinane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.917g/cm3 |
|---|---|
| Boiling Point | 287.5ºC at 760 mmHg |
| Molecular Formula | C15H33N3 |
| Molecular Weight | 255.44300 |
| Flash Point | 113ºC |
| Exact Mass | 255.26700 |
| PSA | 9.72000 |
| LogP | 2.98770 |
| Vapour Pressure | 0.00247mmHg at 25°C |
| Index of Refraction | 1.48 |
| InChIKey | XNJJKNFDJBAYSE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1CN(C(C)(C)C)CN(C(C)(C)C)C1 |
| HS Code | 2933699090 |
|---|
|
~78%
1,3,5-tri-tert-... CAS#:10560-39-1 |
| Literature: Martinez-Aguilera, Luz M. Ruth; Cadenas-Pliego, Gregorio; Contreras, Rosalinda; Flores-Parra, Angelina Tetrahedron: Asymmetry, 1995 , vol. 6, # 7 p. 1585 - 1592 |
| Precursor 2 | |
|---|---|
| DownStream 8 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| EINECS 234-145-8 |
| 1,3,5-Tri-tert-butylhexahydro-1,3,5-triazine |
| 1,3,5-Tri-tert-butylhexahydro-1,3,5-triazin |