1-Chloro-5-isoquinolinesulfonic Acid structure
|
Common Name | 1-Chloro-5-isoquinolinesulfonic Acid | ||
|---|---|---|---|---|
| CAS Number | 105627-80-3 | Molecular Weight | 243.66700 | |
| Density | 1.608g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H6ClNO3S | Melting Point | >250ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloroisoquinoline-5-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.608g/cm3 |
|---|---|
| Melting Point | >250ºC |
| Molecular Formula | C9H6ClNO3S |
| Molecular Weight | 243.66700 |
| Exact Mass | 242.97600 |
| PSA | 75.64000 |
| LogP | 3.21570 |
| Index of Refraction | 1.68 |
| InChIKey | FGQPVNODELDKQF-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1cccc2c(Cl)nccc12 |
| HS Code | 2933499090 |
|---|
|
~%
1-Chloro-5-isoq... CAS#:105627-80-3 |
| Literature: US4678783 A1, ; US 4678783 A |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Chloro-5-isoquinoline Sulfonic Acid |
| 5-Isoquinolinesulfonic acid,1-chloro |
| 1-chloro-5-isoquinolinesulphonic acid |