1-chloroisoquinoline-5-sulfonyl chloride structure
|
Common Name | 1-chloroisoquinoline-5-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 141519-77-9 | Molecular Weight | 262.11300 | |
| Density | N/A | Boiling Point | 405.1±30.0°C at 760 mmHg | |
| Molecular Formula | C9H5Cl2NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloroisoquinoline-5-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 405.1±30.0°C at 760 mmHg |
|---|---|
| Molecular Formula | C9H5Cl2NO2S |
| Molecular Weight | 262.11300 |
| Exact Mass | 260.94200 |
| PSA | 55.41000 |
| LogP | 3.89650 |
| InChIKey | LAFGPNHTRJDGQR-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1cccc2c(Cl)nccc12 |
|
~86%
1-chloroisoquin... CAS#:141519-77-9 |
| Literature: ELI LILLY AND COMPANY Patent: WO2004/94386 A1, 2004 ; Location in patent: Page 27 ; WO 2004/094386 A1 |
|
~80%
1-chloroisoquin... CAS#:141519-77-9 |
| Literature: Collins, Ian; Caldwell, John; Fonseca, Tatiana; Donald, Alastair; Bavetsias, Vassilios; Hunter, Lisa-Jane K.; Garrett, Michelle D.; Rowlands, Martin G.; Aherne, G. Wynne; Davies, Thomas G.; Berdini, Valerio; Woodhead, Steven J.; Davis, Deborah; Seavers, Lisa C. A.; Wyatt, Paul G.; Workman, Paul; McDonald, Edward Bioorganic and Medicinal Chemistry, 2006 , vol. 14, # 4 p. 1255 - 1273 |
|
~%
1-chloroisoquin... CAS#:141519-77-9 |
| Literature: US6248738 B1, ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-chloro-5-chlorosulphonylisoquinoline |
| 1-chloroisoquinoline-5-sulphonyl chloride |
| 1-Chloroisoquinoline-5-sulfonylchloride |
| 1-CHLORO-5-ISOQUINOLINESULFONYL CHLORIDE |
| 5-Isoquinolinesulfonylchloride,1-chloro |
| ZLE0067 |