Phosphonic acid,P-(4-methoxybenzoyl)-, dimethyl ester structure
|
Common Name | Phosphonic acid,P-(4-methoxybenzoyl)-, dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 10570-48-6 | Molecular Weight | 244.18100 | |
| Density | 1.231g/cm3 | Boiling Point | 337.2ºC at 760mmHg | |
| Molecular Formula | C10H13O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.5ºC | |
| Name | dimethoxyphosphoryl-(4-methoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.231g/cm3 |
|---|---|
| Boiling Point | 337.2ºC at 760mmHg |
| Molecular Formula | C10H13O5P |
| Molecular Weight | 244.18100 |
| Flash Point | 171.5ºC |
| Exact Mass | 244.05000 |
| PSA | 71.64000 |
| LogP | 2.32130 |
| Vapour Pressure | 0.000106mmHg at 25°C |
| Index of Refraction | 1.496 |
| InChIKey | TYYKVIUTXZKDQU-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)P(=O)(OC)OC)cc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| <4-Methoxy-benzoyl>-phosphonsaeure-dimethylester |
| dimethyl 4-methoxybenzoyl phosphonate |
| p-Methoxybenzoyl-dimethyl-phosphonat |
| p-methoxybenzoyldimethylphosphonate |
| p-Methoxybenzoyl-phosphonsaeure-dimethylester |