ethyl 2-(3-formyl-4-nitrophenoxy)acetate structure
|
Common Name | ethyl 2-(3-formyl-4-nitrophenoxy)acetate | ||
|---|---|---|---|---|
| CAS Number | 105728-02-7 | Molecular Weight | 253.20800 | |
| Density | 1.333g/cm3 | Boiling Point | 420.3ºC at 760 mmHg | |
| Molecular Formula | C11H11NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.9ºC | |
| Name | ethyl 2-(3-formyl-4-nitrophenoxy)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.333g/cm3 |
|---|---|
| Boiling Point | 420.3ºC at 760 mmHg |
| Molecular Formula | C11H11NO6 |
| Molecular Weight | 253.20800 |
| Flash Point | 194.9ºC |
| Exact Mass | 253.05900 |
| PSA | 98.42000 |
| LogP | 1.87240 |
| Vapour Pressure | 2.85E-07mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | KXFQQSYKWNCRFW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COc1ccc([N+](=O)[O-])c(C=O)c1 |
| HS Code | 2918990090 |
|---|
|
~87%
ethyl 2-(3-form... CAS#:105728-02-7 |
| Literature: Venuti, Michael C.; Jones, Gordon H.; Alvarez, Robert; Bruno, John J. Journal of Medicinal Chemistry, 1987 , vol. 30, # 2 p. 303 - 318 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Acetic acid,(3-formyl-4-nitrophenoxy)-,ethyl ester |
| Ethyl (3-formyl-4-nitrophenoxy)acetate |