Methyl ganoderate C6 structure
|
Common Name | Methyl ganoderate C6 | ||
|---|---|---|---|---|
| CAS Number | 105742-81-2 | Molecular Weight | 544.676 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 679.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C31H44O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.8±25.0 °C | |
Use of Methyl ganoderate C6Methyl ganoderate C6 is a ganoderic acid. Methyl ganoderate C6 can be used for the research of various biochemical[1]. |
| Name | Methyl (3β,5ξ,12β,25R)-3,12-dihydroxy-7,11,15,23-tetraoxolanost-8-en-26-oate |
|---|---|
| Synonym | More Synonyms |
| Description | Methyl ganoderate C6 is a ganoderic acid. Methyl ganoderate C6 can be used for the research of various biochemical[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 679.5±55.0 °C at 760 mmHg |
| Molecular Formula | C31H44O8 |
| Molecular Weight | 544.676 |
| Flash Point | 213.8±25.0 °C |
| Exact Mass | 544.303589 |
| LogP | 2.42 |
| Vapour Pressure | 0.0±4.8 mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | AZCYOYBNOUOOJJ-CGVPIJHZSA-N |
| SMILES | COC(=O)C(C)CC(=O)CC(C)C1CC(=O)C2(C)C3=C(C(=O)C(O)C12C)C1(C)CCC(O)C(C)(C)C1CC3=O |
| Water Solubility | Insuluble (3.4E-3 g/L) (25 ºC) |
| Lanost-8-en-26-oic acid, 3,12-dihydroxy-7,11,15,23-tetraoxo-, methyl ester, (3β,5ξ,12β,25R)- |
| Methyl (3β,5ξ,12β,25R)-3,12-dihydroxy-7,11,15,23-tetraoxolanost-8-en-26-oate |
| Methyl ganoderate C6 |