Estra-1,3,5(10)-trien-17-one,3-methoxy-, oxime (7CI,8CI,9CI) structure
|
Common Name | Estra-1,3,5(10)-trien-17-one,3-methoxy-, oxime (7CI,8CI,9CI) | ||
|---|---|---|---|---|
| CAS Number | 10582-05-5 | Molecular Weight | 299.40700 | |
| Density | 1.26g/cm3 | Boiling Point | 463.8ºC at 760mmHg | |
| Molecular Formula | C19H25NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.3ºC | |
| Name | Estra-1,3,5(10)-trien-17-one, 3-methoxy-, oxime |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 463.8ºC at 760mmHg |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.40700 |
| Flash Point | 234.3ºC |
| Exact Mass | 299.18900 |
| PSA | 41.82000 |
| LogP | 4.38150 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | UPFPBOLHKZHRQR-DUTNZQCHSA-N |
| SMILES | COc1ccc2c(c1)CCC1C2CCC2(C)C(=NO)CCC12 |
|
~%
Estra-1,3,5(10)... CAS#:10582-05-5 |
| Literature: Journal of the American Chemical Society, , vol. 78, p. 639,642 Biochemical Journal, , vol. 26, p. 25,28 |
|
~%
Estra-1,3,5(10)... CAS#:10582-05-5 |
| Literature: Biochemical Journal, , vol. 26, p. 25,28 |
|
~%
Estra-1,3,5(10)... CAS#:10582-05-5 |
| Literature: Biochemical Journal, , vol. 26, p. 25,28 |
|
~%
Estra-1,3,5(10)... CAS#:10582-05-5 |
| Literature: Biochemical Journal, , vol. 26, p. 25,28 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 17-hydroxyimino-3-methoxyestra-1,3,5(10)-triene |
| 3-methoxy-estra-1,3,5(10)-trien-17-one oxime |
| 3-O-Methyl-oestron-17-oxim |
| 17-Hydroxy-heptadecansaeure-methylester |
| 3-methoxyestra-1,3-5(10)-trien-17-oxime |
| 17-hydroxy-heptadecanoic acid methyl ester |
| 3-Methoxy-oestra-1,3,5(10)-trien-17-on-oxim |
| Heptadecanoic acid,17-hydroxy-,methyl ester |