4,8-Dimethoxy-2-naphthoic acid structure
|
Common Name | 4,8-Dimethoxy-2-naphthoic acid | ||
|---|---|---|---|---|
| CAS Number | 105901-90-4 | Molecular Weight | 232.23200 | |
| Density | 1.261g/cm3 | Boiling Point | 407.1ºC at 760 mmHg | |
| Molecular Formula | C13H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.2ºC | |
| Name | 4,8-Dimethoxy-2-naphthoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.261g/cm3 |
|---|---|
| Boiling Point | 407.1ºC at 760 mmHg |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23200 |
| Flash Point | 158.2ºC |
| Exact Mass | 232.07400 |
| PSA | 55.76000 |
| LogP | 2.55520 |
| Vapour Pressure | 2.34E-07mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | VLSHUNALBMISTE-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)O)cc2c(OC)cccc12 |
|
~%
4,8-Dimethoxy-2... CAS#:105901-90-4 |
| Literature: El-Abbady; El-Assal Journal of the Chemical Society, 1959 , p. 1024 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 4,8-dimethoxynaphth-1-ol |
| 4,8-dimethoxy-1-naphthalenol |
| 1-Naphthalenol,4,8-dimethoxy |