Methyl 4,8-dimethoxy-2-naphthoate structure
|
Common Name | Methyl 4,8-dimethoxy-2-naphthoate | ||
|---|---|---|---|---|
| CAS Number | 107775-36-0 | Molecular Weight | 246.25900 | |
| Density | N/A | Boiling Point | 386.9ºC at 760 mmHg | |
| Molecular Formula | C14H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.2ºC | |
| Name | Methyl 4,8-dimethoxy-2-naphthoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 386.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.25900 |
| Flash Point | 172.2ºC |
| Exact Mass | 246.08900 |
| PSA | 44.76000 |
| LogP | 2.64360 |
| Vapour Pressure | 3.43E-06mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | ZYULXZGPCYKSPY-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OC)c2cccc(OC)c2c1 |
|
~%
Methyl 4,8-dime... CAS#:107775-36-0 |
| Literature: Horii,Z.-I. et al. Chemical and Pharmaceutical Bulletin, 1971 , vol. 19, p. 1245 - 1256 |
| 4,8-dimethoxynaphth-1-ol |
| 4,8-dimethoxy-1-naphthalenol |
| 1-Naphthalenol,4,8-dimethoxy |