1-methyl-7-propoxy-9H-pyrido[3,4-b]indole structure
|
Common Name | 1-methyl-7-propoxy-9H-pyrido[3,4-b]indole | ||
|---|---|---|---|---|
| CAS Number | 10593-57-4 | Molecular Weight | 240.30000 | |
| Density | 1.186g/cm3 | Boiling Point | 437.7ºC at 760 mmHg | |
| Molecular Formula | C15H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.4ºC | |
| Name | 1-methyl-7-propoxy-9H-pyrido[3,4-b]indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.186g/cm3 |
|---|---|
| Boiling Point | 437.7ºC at 760 mmHg |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.30000 |
| Flash Point | 144.4ºC |
| Exact Mass | 240.12600 |
| PSA | 37.91000 |
| LogP | 3.81330 |
| Vapour Pressure | 1.89E-07mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | ROPQRKIYWVDATM-UHFFFAOYSA-N |
| SMILES | CCCOc1ccc2c(c1)[nH]c1c(C)nccc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| O-n-Propyl-harmol |
| Propyl harmol |