EC0488
Modify Date: 2025-09-18 02:27:02
EC0488 structure
|
Common Name | EC0488 | ||
|---|---|---|---|---|
| CAS Number | 1059477-92-7 | Molecular Weight | 1679.63 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C65H98N16O34S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of EC0488EC0488 is used to synthesize EC0531 with folate receptor (FR)-specific and anti-tumor activities[1]. |
| Name | EC0488 |
|---|
| Description | EC0488 is used to synthesize EC0531 with folate receptor (FR)-specific and anti-tumor activities[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C65H98N16O34S |
|---|---|
| Molecular Weight | 1679.63 |
| InChIKey | MFUGDMCMTPUQPX-KUIZGTAOSA-N |
| SMILES | Nc1nc2ncc(CNc3ccc(C(=O)NC(CCC(=O)NC(CCC(=O)NCC(O)C(O)C(O)C(O)CO)C(=O)NC(CCC(=O)O)C(=O)NC(CCC(=O)NCC(O)C(O)C(O)C(O)CO)C(=O)NC(CCC(=O)O)C(=O)NC(CCC(=O)NCC(O)C(O)C(O)C(O)CO)C(=O)NC(CS)C(=O)O)C(=O)O)cc3)nc2c(=O)[nH]1 |