Octanoic acid,tributylstannyl ester
Modify Date: 2025-09-19 13:44:46
Octanoic acid,tributylstannyl ester structure
|
Common Name | Octanoic acid,tributylstannyl ester | ||
|---|---|---|---|---|
| CAS Number | 10603-63-1 | Molecular Weight | 433.24700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H42O2Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Octanoic acid,tributylstannyl ester |
|---|
| Molecular Formula | C20H42O2Sn |
|---|---|
| Molecular Weight | 433.24700 |
| Exact Mass | 434.22100 |
| PSA | 40.13000 |
| LogP | 5.57780 |
| InChIKey | IDROVICGMCMYRR-UHFFFAOYSA-M |
| SMILES | CCCCCCCC(=O)O[Sn](CCCC)(CCCC)CCCC |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |