(2S)-2-N-[(2S)-2-[[(2S)-1-[(2S)-2-amino-6-formamidohexanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]-1-N-(2-chloroethyl)-1-N-nitrosopyrrolidine-1,2-dicarboxamide structure
|
Common Name | (2S)-2-N-[(2S)-2-[[(2S)-1-[(2S)-2-amino-6-formamidohexanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]-1-N-(2-chloroethyl)-1-N-nitrosopyrrolidine-1,2-dicarboxamide | ||
|---|---|---|---|---|
| CAS Number | 106039-85-4 | Molecular Weight | 601.09500 | |
| Density | 1.45g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C25H41ClN8O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S)-2-N-[(2S)-2-[[(2S)-1-[(2S)-2-amino-6-formamidohexanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]-1-N-(2-chloroethyl)-1-N-nitrosopyrrolidine-1,2-dicarboxamide |
|---|
| Density | 1.45g/cm3 |
|---|---|
| Molecular Formula | C25H41ClN8O7 |
| Molecular Weight | 601.09500 |
| Exact Mass | 600.27900 |
| PSA | 214.15000 |
| LogP | 2.90820 |
| Index of Refraction | 1.638 |
| InChIKey | JYBZATLITVSDKL-MUGJNUQGSA-N |
| SMILES | CC(C)C(NC(=O)C1CCCN1C(=O)C(N)CCCCNC=O)C(=O)NC(=O)C1CCCN1C(=O)N(CCCl)N=O |
|
~58%
(2S)-2-N-[(2S)-... CAS#:106039-85-4 |
| Literature: Suli-Vargha; Jeney; Lapis; Medzihradszky Journal of Medicinal Chemistry, 1987 , vol. 30, # 3 p. 583 - 586 |
|
~%
(2S)-2-N-[(2S)-... CAS#:106039-85-4 |
| Literature: Suli-Vargha; Jeney; Lapis; Medzihradszky Journal of Medicinal Chemistry, 1987 , vol. 30, # 3 p. 583 - 586 |
|
~%
(2S)-2-N-[(2S)-... CAS#:106039-85-4 |
| Literature: Suli-Vargha; Jeney; Lapis; Medzihradszky Journal of Medicinal Chemistry, 1987 , vol. 30, # 3 p. 583 - 586 |