Diphenylbis(pentafluorophenyl)stannane structure
|
Common Name | Diphenylbis(pentafluorophenyl)stannane | ||
|---|---|---|---|---|
| CAS Number | 1062-67-5 | Molecular Weight | 607.02100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H10F10Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(perfluorophenyl)diphenylstannane |
|---|
| Molecular Formula | C24H10F10Sn |
|---|---|
| Molecular Weight | 607.02100 |
| Exact Mass | 607.96400 |
| LogP | 4.45500 |
| InChIKey | MUYJJXJEBQTBMM-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c([Sn](c2ccccc2)(c2ccccc2)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| HS Code | 2931900090 |
|---|
|
~%
Diphenylbis(pen... CAS#:1062-67-5 |
| Literature: Gmelin Handbook: Sn: Org.Verb.3, 1.1.3.6, page 57 - 68 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |