Methyltris(pentafluorophenyl)stannane structure
|
Common Name | Methyltris(pentafluorophenyl)stannane | ||
|---|---|---|---|---|
| CAS Number | 1062-71-1 | Molecular Weight | 635.91200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H4F15Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl-tris(2,3,4,5,6-pentafluorophenyl)stannane |
|---|
| Molecular Formula | C19H4F15Sn |
|---|---|
| Molecular Weight | 635.91200 |
| Exact Mass | 636.91000 |
| LogP | 8.26950 |
| InChIKey | ZDNZXKMCNCTLGN-UHFFFAOYSA-N |
| SMILES | C[Sn](c1c(F)c(F)c(F)c(F)c1F)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| HS Code | 2931900090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |