S-(3-nitrobenzoyl)sulfanyl 3-nitrobenzenecarbothioate
S-(3-nitrobenzoyl)sulfanyl 3-nitrobenzenecarbothioate structure
|
Common Name | S-(3-nitrobenzoyl)sulfanyl 3-nitrobenzenecarbothioate | ||
|---|---|---|---|---|
| CAS Number | 106274-98-0 | Molecular Weight | 364.35300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H8N2O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | S-(3-nitrobenzoyl)sulfanyl 3-nitrobenzenecarbothioate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H8N2O6S2 |
|---|---|
| Molecular Weight | 364.35300 |
| Exact Mass | 363.98200 |
| PSA | 176.38000 |
| LogP | 4.91140 |
| InChIKey | JERYZADCABLMOS-UHFFFAOYSA-N |
| SMILES | O=C(SSC(=O)c1cccc([N+](=O)[O-])c1)c1cccc([N+](=O)[O-])c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~80%
S-(3-nitrobenzo... CAS#:106274-98-0 |
| Literature: Wang; Cui; Hu; Zhao Synthetic Communications, 1995 , vol. 25, # 6 p. 889 - 898 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of S-(3-nitrobenzoyl)sulfanyl 3-nitrobenzenecarbothioate? |
| A: LogP of S-(3-nitrobenzoyl)sulfanyl 3-nitrobenzenecarbothioate is 4.91140. |
| Q: What is the SMILES notation of S-(3-nitrobenzoyl)sulfanyl 3-nitrobenzenecarbothioate? |
| A: SMILES notation of S-(3-nitrobenzoyl)sulfanyl 3-nitrobenzenecarbothioate is O=C(SSC(=O)c1cccc([N+](=O)[O-])c1)c1cccc([N+](=O)[O-])c1. |
| Q: What is the polar surface area (PSA) of S-(3-nitrobenzoyl)sulfanyl 3-nitrobenzenecarbothioate? |
| A: Polar surface area (PSA) of S-(3-nitrobenzoyl)sulfanyl 3-nitrobenzenecarbothioate is 176.38000. |
| Q: What is the molecular formula of S-(3-nitrobenzoyl)sulfanyl 3-nitrobenzenecarbothioate? |
| A: Molecular formula of S-(3-nitrobenzoyl)sulfanyl 3-nitrobenzenecarbothioate is C14H8N2O6S2. |
| Q: What is the CAS number of S-(3-nitrobenzoyl)sulfanyl 3-nitrobenzenecarbothioate? |
| A: CAS number of S-(3-nitrobenzoyl)sulfanyl 3-nitrobenzenecarbothioate is 106274-98-0. |
| Q: What is the English name of S-(3-nitrobenzoyl)sulfanyl 3-nitrobenzenecarbothioate? |
| A: The English name of S-(3-nitrobenzoyl)sulfanyl 3-nitrobenzenecarbothioate is S-(3-nitrobenzoyl)sulfanyl 3-nitrobenzenecarbothioate. |
| Q: What is the Chinese name of 106274-98-0? |
| A: Chinese name of 106274-98-0 is 106274-98-0. |
| Q: What are the upstream materials of S-(3-nitrobenzoyl)sulfanyl 3-nitrobenzenecarbothioate? |
| A: Related upstream materials(CAS) of S-(3-nitrobenzoyl)sulfanyl 3-nitrobenzenecarbothioate: 121-90-4. |
| Q: What is the molecular weight of S-(3-nitrobenzoyl)sulfanyl 3-nitrobenzenecarbothioate? |
| A: Molecular weight of S-(3-nitrobenzoyl)sulfanyl 3-nitrobenzenecarbothioate is 364.35300. |
| Q: What is the InChIKey of S-(3-nitrobenzoyl)sulfanyl 3-nitrobenzenecarbothioate? |
| A: InChIKey of S-(3-nitrobenzoyl)sulfanyl 3-nitrobenzenecarbothioate is JERYZADCABLMOS-UHFFFAOYSA-N. |