3-Nitrobenzoyl chloride structure
|
Common Name | 3-Nitrobenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 121-90-4 | Molecular Weight | 185.565 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 277.3±13.0 °C at 760 mmHg | |
| Molecular Formula | C7H4ClNO3 | Melting Point | 31-34 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 121.5±19.8 °C | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | 3-Nitrobenzoyl Chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 277.3±13.0 °C at 760 mmHg |
| Melting Point | 31-34 °C(lit.) |
| Molecular Formula | C7H4ClNO3 |
| Molecular Weight | 185.565 |
| Flash Point | 121.5±19.8 °C |
| Exact Mass | 184.987976 |
| PSA | 62.89000 |
| LogP | 2.12 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | NXTNASSYJUXJDV-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1cccc([N+](=O)[O-])c1 |
| Water Solubility | decomposes |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H311-H314 |
| Supplemental HS | Risk of explosion if heated under confinement. |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R21;R34 |
| Safety Phrases | S26-S36/37/39-S45-S7/9-S38 |
| RIDADR | UN 2923 8/PG 3 |
| WGK Germany | 3 |
| RTECS | DM6646000 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 29163900 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Synthesis and cytotoxic effect of carbocyclic potential minor groove binders.
Il Farmaco 59(3) , 211-4, (2004) New carbocyclic potential minor groove binders were synthesised, using 3-nitrobenzoyl chloride and aliphatic alpha,omega-diamines with three, four and five methylene fragments. The half structures, co... |
|
|
The effect of inhibition of (ADP-ribose)n biosynthesis on DNA repair assayed by the nucleoid technique.
Eur. J. Biochem. 121(1) , 65-9, (1981) DNA damage and repair was assayed by the loss and restoration of DNA supercoiling in nucleoids. This technique was used to assess the effects of inhibition of (ADP-ribose)n biosynthesis by 3-aminobenz... |
| 3-Nitrobenzoyl chloride |
| MFCD00007247 |
| EINECS 204-505-9 |
| m-Nitrobenzoyl chloride |