4-Methoxy-2-(trifluoromethyl)benzaldehyde structure
|
Common Name | 4-Methoxy-2-(trifluoromethyl)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 106312-36-1 | Molecular Weight | 204.146 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 256.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C9H7F3O2 | Melting Point | 39-41°C | |
| MSDS | USA | Flash Point | 105.6±22.2 °C | |
| Name | 4-Methoxy-2-(trifluoromethyl)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 256.2±40.0 °C at 760 mmHg |
| Melting Point | 39-41°C |
| Molecular Formula | C9H7F3O2 |
| Molecular Weight | 204.146 |
| Flash Point | 105.6±22.2 °C |
| Exact Mass | 204.039810 |
| PSA | 26.30000 |
| LogP | 3.16 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.475 |
| InChIKey | BVPVUMRIGHMFNV-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=O)c(C(F)(F)F)c1 |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | 43 |
| Safety Phrases | 36/37 |
| HS Code | 2913000090 |
|
~%
4-Methoxy-2-(tr... CAS#:106312-36-1 |
| Literature: Synthesis, , # 12 art. no. T20108SS, p. 2040 - 2060 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| 4-methoxy-2-trifluoromethylbenzaldehyde |
| EINECS MFCD01091011 |
| 4-(methyloxy)-2-(trifluoromethyl)benzaldehyde |
| 4-Methoxy-2-(trifluoromethyl)benzaldehyde |
| 2-(Trifluoromethyl)-p-anisaldehyde |
| Benzaldehyde, 4-methoxy-2-(trifluoromethyl)- |
| Benzaldehyde,4-methoxy-2-(trifluoromethyl) |
| 2-trifluoromethyl-4-methoxybenzaldehyde |
| MFCD01091011 |
| 4-Formyl-3-(trifluoromethyl)anisole |
| VHR DO1 BXFFF |