Epoxiconazole structure
|
Common Name | Epoxiconazole | ||
|---|---|---|---|---|
| CAS Number | 106325-08-0 | Molecular Weight | 329.756 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 463.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C17H13ClFN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.9±31.5 °C | |
| Name | Epoxiconazol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 463.1±55.0 °C at 760 mmHg |
| Molecular Formula | C17H13ClFN3O |
| Molecular Weight | 329.756 |
| Flash Point | 233.9±31.5 °C |
| Exact Mass | 329.073120 |
| PSA | 43.24000 |
| LogP | 3.44 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.659 |
| InChIKey | ZMYFCFLJBGAQRS-ZYMOGRSISA-N |
| SMILES | Fc1ccc(C2(Cn3cncn3)OC2c2ccccc2Cl)cc1 |
| Storage condition | 0-6°C |
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment; |
|---|---|
| Risk Phrases | R40;R51/53;R62;R63 |
| Safety Phrases | S36/37-S46-S61 |
| RIDADR | UN 3077 |
| HS Code | 2933199090 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EPOXICONAZOL PESTANAL,250 MG |
| 1-{[3-(2-Chlorphenyl)-2-(4-fluorphenyl)oxiran-2-yl]methyl}-1H-1,2,4-triazol |
| Epxiconazole |
| epoxyconazole |
| 1-[[3-(2-Chlorophenyl)-2-(4-fluorophenyl)oxiranyl]methyl]-1H-1,2,4-triazole |
| 1-{[3-(2-Chlorophenyl)-2-(4-fluorophenyl)-2-oxiranyl]methyl}-1H-1,2,4-triazole |
| 1H-1,2,4-Triazole, 1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiranyl]methyl]- |
| Opus |
| (2RS,3SR)-1-[3-(2-chlorophenyl)-2,3-epoxy-2-(4-fluorophenyl)propyl]-1H-1,2,4-triazole |
| 1-{[3-(2-Chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl}-1H-1,2,4-triazole |