Hexaphenylditin structure
|
Common Name | Hexaphenylditin | ||
|---|---|---|---|---|
| CAS Number | 1064-10-4 | Molecular Weight | 700.02500 | |
| Density | N/A | Boiling Point | 280ºC | |
| Molecular Formula | C36H30Sn2 | Melting Point | 232.5ºC | |
| MSDS | Chinese USA | Flash Point | 280°C | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
| Name | triphenyltin |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 280ºC |
|---|---|
| Melting Point | 232.5ºC |
| Molecular Formula | C36H30Sn2 |
| Molecular Weight | 700.02500 |
| Flash Point | 280°C |
| Exact Mass | 702.03900 |
| LogP | 4.40560 |
| Appearance of Characters | white,Powder |
| InChIKey | UAPQJVJCJITJET-UHFFFAOYSA-N |
| SMILES | c1ccc([Sn](c2ccccc2)c2ccccc2)cc1.c1ccc([Sn](c2ccccc2)c2ccccc2)cc1 |
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 + H311 + H331-H410 |
| Precautionary Statements | Missing Phrase - N15.00950417-P261-P280-P302 + P352 + P312-P304 + P340 + P312-P403 + P233 |
| Hazard Codes | T: Toxic;N: Dangerous for the environment; |
| Risk Phrases | 23/24/25-50/53 |
| Safety Phrases | 26-27-28-45-60-61 |
| RIDADR | UN 3146 6.1/PG 3 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| hexaphenylstannane |
| Distannane,hexaphenyl |
| hexaphenyldilead |
| Hexaphenyldistannane |
| MFCD00014070 |
| Hexaphenylditin(IV) |
| EINECS 213-902-6 |
| Hexaphenylditin |