7-amino-3-[(z)-prop-1-enyl]-3-cephem-4-carboxylic acid structure
|
Common Name | 7-amino-3-[(z)-prop-1-enyl]-3-cephem-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 106447-44-3 | Molecular Weight | 240.27900 | |
| Density | 1.5g/cm3 | Boiling Point | 539.275ºC at 760 mmHg | |
| Molecular Formula | C10H12N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.944ºC | |
| Name | 7-Amino-8-oxo-3-[(1Z)-1-propen-1-yl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 539.275ºC at 760 mmHg |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.27900 |
| Flash Point | 279.944ºC |
| Exact Mass | 240.05700 |
| PSA | 108.93000 |
| LogP | 0.78180 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.685 |
| InChIKey | ZYLDQHILNOZKIF-OXLALJFOSA-N |
| SMILES | CC=CC1=C(C(=O)O)N2C(=O)C(N)C2SC1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 43 |
| Safety Phrases | 22-24-37 |
| RIDADR | NONH for all modes of transport |
|
~%
7-amino-3-[(z)-... CAS#:106447-44-3 |
| Literature: WO2005/42543 A1, ; Page/Page column 18 ; |
| pyridinium-7-aminocephalosporonic acid hydroiodide |
| Cefprozil Related Compound D |
| Cefprozil Impurity D |