N-Boc-D-phenylalaninol structure
|
Common Name | N-Boc-D-phenylalaninol | ||
|---|---|---|---|---|
| CAS Number | 106454-69-7 | Molecular Weight | 251.321 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 410.1±38.0 °C at 760 mmHg | |
| Molecular Formula | C14H21NO3 | Melting Point | 95-98ºC | |
| MSDS | USA | Flash Point | 201.8±26.8 °C | |
| Name | N-Boc-D-phenylalaninol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 410.1±38.0 °C at 760 mmHg |
| Melting Point | 95-98ºC |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.321 |
| Flash Point | 201.8±26.8 °C |
| Exact Mass | 251.152145 |
| PSA | 58.56000 |
| LogP | 2.64 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.520 |
| InChIKey | LDKDMDVMMCXTMO-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CO)Cc1ccccc1 |
| Storage condition | 2-8°C |
| Precursor 9 | |
|---|---|
| DownStream 4 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| tert-butyl N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]carbamate |
| N-(tert-Butoxycarbonyl)-D-phenylalaninol |
| Carbamic acid, [1-(hydroxymethyl)-2-phenylethyl]-, 1,1-dimethylethyl ester, (s)- |
| Carbamic acid, N-[(1S)-2-hydroxy-1-(phenylmethyl)ethyl]-, 1,1-dimethylethyl ester |
| N-Boc-D-Phenylalaninol |
| (R)-tert-Butyl (1-hydroxy-3-phenylpropan-2-yl)carbamate |
| Carbamic acid, N-[(1R)-2-hydroxy-1-(phenylmethyl)ethyl]-, 1,1-dimethylethyl ester |
| N-t-BOC-D-Phenylalaninol |
| tert-Butyl [(2R)-1-hydroxy-3-phenylpropan-2-yl]carbamate |
| tert-Butyl [(2S)-1-hydroxy-3-phenylpropan-2-yl]carbamate |
| MFCD05865075 |
| (R)-2-(Boc-amino)-3-phenyl-1-propanol |
| 2-Methyl-2-propanyl [(2R)-1-hydroxy-3-phenyl-2-propanyl]carbamate |
| (S)-2-(Boc-amino)-3-phenyl-1-propanol |
| 2-Methyl-2-propanyl [(2S)-1-hydroxy-3-phenyl-2-propanyl]carbamate |
| (R)-2-(tert-Butoxycarbonylamino)-3-phenyl-1-propanol |
| Boc-D-Phe-ol |
| Boc-D-Phenylalaninol |