2-bromo-N-[2-[4-[[2-hydroxy-3-(1H-indol-4-yloxy)propyl]amino]-4-methylcyclohexyl]propan-2-yl]acetamide structure
|
Common Name | 2-bromo-N-[2-[4-[[2-hydroxy-3-(1H-indol-4-yloxy)propyl]amino]-4-methylcyclohexyl]propan-2-yl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 106469-51-6 | Molecular Weight | 480.43800 | |
| Density | 1.33g/cm3 | Boiling Point | 697.2ºC at 760mmHg | |
| Molecular Formula | C23H34BrN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 375.5ºC | |
| Name | 2-bromo-N-[2-[4-[[2-hydroxy-3-(1H-indol-4-yloxy)propyl]amino]-4-methylcyclohexyl]propan-2-yl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 697.2ºC at 760mmHg |
| Molecular Formula | C23H34BrN3O3 |
| Molecular Weight | 480.43800 |
| Flash Point | 375.5ºC |
| Exact Mass | 479.17800 |
| PSA | 86.38000 |
| LogP | 4.51760 |
| Vapour Pressure | 2.09E-20mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | KNGWXFIRAISQAP-UHFFFAOYSA-N |
| SMILES | CC1(NCC(O)COc2cccc3[nH]ccc23)CCC(C(C)(C)NC(=O)CBr)CC1 |
| WGK Germany | 3 |
|---|
|
~%
2-bromo-N-[2-[4... CAS#:106469-51-6 |
| Literature: Pitha, Josef; Buchowiecki, Wieslaw; Milecki, Jan; Kusiak, John W. Journal of Medicinal Chemistry, 1987 , vol. 30, # 4 p. 612 - 615 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N8-(bromoacetyl)-N1-[3-(4-indolyloxy)-2-hydroxypropyl]-(Z)-1,8-diamino-p-menthane |
| Pindobind-5HT1A |
| N8-Bim |
| 2-bromo-n-[2-(4-{[2-hydroxy-3-(1h-indol-4-yloxy)propyl]amino}-4-methylcyclohexyl)propan-2-yl]acetamide |
| (+/-)-Pindobind |