(+/-)-PINDOBIND structure
|
Common Name | (+/-)-PINDOBIND | ||
|---|---|---|---|---|
| CAS Number | 106469-52-7 | Molecular Weight | 480.43800 | |
| Density | 1.33g/cm3 | Boiling Point | 692.7ºC at 760mmHg | |
| Molecular Formula | C23H34BrN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 372.7ºC | |
| Name | 2-bromo-N-[4-[2-[[2-hydroxy-3-(1H-indol-4-yloxy)propyl]amino]propan-2-yl]-1-methylcyclohexyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 692.7ºC at 760mmHg |
| Molecular Formula | C23H34BrN3O3 |
| Molecular Weight | 480.43800 |
| Flash Point | 372.7ºC |
| Exact Mass | 479.17800 |
| PSA | 89.87000 |
| LogP | 4.96700 |
| Vapour Pressure | 3.83E-20mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | XSAGAZCYTLNCEN-UHFFFAOYSA-N |
| SMILES | CC1(NC(=O)CBr)CCC(C(C)(C)NCC(O)COc2cccc3[nH]ccc23)CC1 |
| WGK Germany | 3 |
|---|
|
~%
(+/-)-PINDOBIND CAS#:106469-52-7 |
| Literature: Pitha, Josef; Buchowiecki, Wieslaw; Milecki, Jan; Kusiak, John W. Journal of Medicinal Chemistry, 1987 , vol. 30, # 4 p. 612 - 615 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Pindobind |