Methyl 2,2,3,4,4,4-hexafluorobutanoate structure
|
Common Name | Methyl 2,2,3,4,4,4-hexafluorobutanoate | ||
|---|---|---|---|---|
| CAS Number | 106538-78-7 | Molecular Weight | 210.07400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H4F6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 2,2,3,4,4,4-hexafluorobutanoate |
|---|
| Molecular Formula | C5H4F6O2 |
|---|---|
| Molecular Weight | 210.07400 |
| Exact Mass | 210.01200 |
| PSA | 26.30000 |
| LogP | 1.69510 |
| InChIKey | IEOIDFVMNOXBAU-UHFFFAOYSA-N |
| SMILES | COC(=O)C(F)(F)C(F)C(F)(F)F |
| HS Code | 2915900090 |
|---|
|
~5%
Detail
|
| Literature: Chambers, Richard D.; Grievson, Brian; Kelly, Noel M. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 2209 - 2214 |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |