WAY-299765 structure
|
Common Name | WAY-299765 | ||
|---|---|---|---|---|
| CAS Number | 106578-02-3 | Molecular Weight | 243.28 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 440.1±33.0 °C at 760 mmHg | |
| Molecular Formula | C13H9NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.0±25.4 °C | |
Use of WAY-299765WAY-299765 is an active molecule. |
| Name | WAY-299765 |
|---|---|
| Synonym | More Synonyms |
| Description | WAY-299765 is an active molecule. |
|---|---|
| Related Catalog |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 440.1±33.0 °C at 760 mmHg |
| Molecular Formula | C13H9NO2S |
| Molecular Weight | 243.28 |
| Flash Point | 220.0±25.4 °C |
| Exact Mass | 243.035400 |
| LogP | 2.92 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.656 |
| InChIKey | XVGKZNSQFDIWRA-UHFFFAOYSA-N |
| SMILES | Cc1nc(-c2cc3ccccc3oc2=O)cs1 |
| 2H-1-Benzopyran-2-one, 3-(2-methyl-4-thiazolyl)- |
| 3-(2-Methyl-4-thiazolyl)-2H-1-benzopyran-2-one |
| 3-(2-Methyl-1,3-thiazol-4-yl)-2H-chromen-2-one |