N-[2-(dimethylamino)ethyl]acridine-1-carboxamide
Modify Date: 2025-09-25 19:06:18
![N-[2-(dimethylamino)ethyl]acridine-1-carboxamide Structure](https://image.chemsrc.com/caspic/058/106626-55-5.png)
N-[2-(dimethylamino)ethyl]acridine-1-carboxamide structure
|
Common Name | N-[2-(dimethylamino)ethyl]acridine-1-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 106626-55-5 | Molecular Weight | 293.36300 | |
| Density | 1.182g/cm3 | Boiling Point | 544.1ºC at 760mmHg | |
| Molecular Formula | C18H19N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.9ºC | |
| Name | N-[2-(dimethylamino)ethyl]acridine-1-carboxamide |
|---|
| Density | 1.182g/cm3 |
|---|---|
| Boiling Point | 544.1ºC at 760mmHg |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.36300 |
| Flash Point | 282.9ºC |
| Exact Mass | 293.15300 |
| PSA | 45.23000 |
| LogP | 3.07030 |
| Vapour Pressure | 6.73E-12mmHg at 25°C |
| Index of Refraction | 1.657 |
| InChIKey | HASYMRDFVCNFGG-UHFFFAOYSA-N |
| SMILES | CN(C)CCNC(=O)c1cccc2nc3ccccc3cc12 |
|
~%
N-[2-(dimethyla... CAS#:106626-55-5 |
| Literature: Journal of Medicinal Chemistry, , vol. 30, # 4 p. 664 - 669 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |