N-[5-(dimethylamino)pentyl]acridine-4-carboxamide structure
|
Common Name | N-[5-(dimethylamino)pentyl]acridine-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 106626-59-9 | Molecular Weight | 335.44300 | |
| Density | 1.127g/cm3 | Boiling Point | 574.2ºC at 760 mmHg | |
| Molecular Formula | C21H25N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301ºC | |
| Name | N-[5-(dimethylamino)pentyl]acridine-4-carboxamide |
|---|
| Density | 1.127g/cm3 |
|---|---|
| Boiling Point | 574.2ºC at 760 mmHg |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.44300 |
| Flash Point | 301ºC |
| Exact Mass | 335.20000 |
| PSA | 48.72000 |
| LogP | 4.42450 |
| Vapour Pressure | 3.45E-13mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | VGDOQPDIQDNTDF-UHFFFAOYSA-N |
| SMILES | CN(C)CCCCCNC(=O)c1cccc2cc3ccccc3nc12 |
|
~%
N-[5-(dimethyla... CAS#:106626-59-9 |
| Literature: Atwell, Graham J.; Rewcastle, Gordon W.; Baguley, Bruce C.; Denny, William A. Journal of Medicinal Chemistry, 1987 , vol. 30, # 4 p. 664 - 669 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |