Mehtyl 6-[3-(1-adamanty)-4-methoxy phenyl]-2-naphthoate structure
|
Common Name | Mehtyl 6-[3-(1-adamanty)-4-methoxy phenyl]-2-naphthoate | ||
|---|---|---|---|---|
| CAS Number | 106685-41-0 | Molecular Weight | 426.547 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 589.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C29H30O3 | Melting Point | 223-225°C | |
| MSDS | N/A | Flash Point | 258.7±24.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Adapalene Methyl Ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 589.6±50.0 °C at 760 mmHg |
| Melting Point | 223-225°C |
| Molecular Formula | C29H30O3 |
| Molecular Weight | 426.547 |
| Flash Point | 258.7±24.7 °C |
| Exact Mass | 426.219482 |
| PSA | 35.53000 |
| LogP | 8.34 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | PGXNMQBGOVUZNC-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2cc(-c3ccc(OC)c(C45CC6CC(CC(C6)C4)C5)c3)ccc2c1 |
| Storage condition | Refrigerator |
| Precursor 8 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl 6-[3-(1-adamantyl)-4-methoxyphenyl]naphthalene-2-carboxylate |
| Methyl 6-[3-(1-adamantyl)-4-methoxyphenyl]-2-naphthoate |
| methyl 6-[3-(1-adamantane)-4-methoxyphenyl]-2-naphth |
| Adapalene Related Compound B |
| 2-Naphthalenecarboxylic acid, 6-(4-methoxy-3-tricyclo[3.3.1.1]dec-1-ylphenyl)-, methyl ester |
| methyl 6-[4-methoxy-3-(tricyclo[3.3.1.1]dec-1-yl)phenyl]naphthalene-2-carboxylate |
| Methyl 6-[3-(adamantan-1-yl)-4-methoxyphenyl]-2-naphthoate |
| Methyl 6-{3-[(3s,5s,7s)-adamantan-1-yl]-4-methoxyphenyl}-2-naphthoate |
| Methyl 6-(3-(adamantan-1-yl)-4-methoxyphenyl)-2-naphthoate |