1-acetyl-5-bromoindolin-3-one structure
|
Common Name | 1-acetyl-5-bromoindolin-3-one | ||
|---|---|---|---|---|
| CAS Number | 106698-07-1 | Molecular Weight | 254.080 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 487.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C10H8BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.7±28.7 °C | |
| Name | 1-acetyl-5-bromo-2H-indol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 487.7±45.0 °C at 760 mmHg |
| Molecular Formula | C10H8BrNO2 |
| Molecular Weight | 254.080 |
| Flash Point | 248.7±28.7 °C |
| Exact Mass | 252.973831 |
| PSA | 37.38000 |
| LogP | 1.76 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | KXJGSNRAQWDDJT-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CC(=O)c2cc(Br)ccc21 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~80%
1-acetyl-5-brom... CAS#:106698-07-1 |
| Literature: Guyen, Berangere; Schultes, Christoph M.; Hazel, Pascale; Mann, John; Neidle, Stephen Organic and Biomolecular Chemistry, 2004 , vol. 2, # 7 p. 981 - 988 |
|
~93%
1-acetyl-5-brom... CAS#:106698-07-1 |
| Literature: Chien, Chun-Sheng; Hasegawa, Atsushi; Kawasaki, Tomomi; Sakamoto, Masanori Chemical & Pharmaceutical Bulletin, 1986 , vol. 34, # 4 p. 1493 - 1496 |
|
~%
1-acetyl-5-brom... CAS#:106698-07-1 |
| Literature: Chemical & Pharmaceutical Bulletin, , vol. 34, # 4 p. 1493 - 1496 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Brom-N-acetylindoxyl |
| 3H-Indol-3-one, 1-acetyl-5-bromo-1,2-dihydro- |
| 5-bromo-1-acetyl indoxyl |
| 1-Acetyl-5-bromo-1,2-dihydro-3H-indol-3-one |
| KXJGSNRAQWDDJT-UHFFFAOYSA |
| 1-acetyl-5-bromoindolin-3-one |
| 1-acetyl-5-bromoindoxyl |
| 1-acetyl-5-bromo-1,2-dihydroindol-3-one |
| 1-acetyl-5-bromo-3-indolinone |