N-(2-(diethylamino)ethyl)-4-iodobenzamide structure
|
Common Name | N-(2-(diethylamino)ethyl)-4-iodobenzamide | ||
|---|---|---|---|---|
| CAS Number | 106790-96-9 | Molecular Weight | 346.20700 | |
| Density | 1.432g/cm3 | Boiling Point | 418.7ºC at 760mmHg | |
| Molecular Formula | C13H19IN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207ºC | |
| Name | N-[2-(Diethylamino)ethyl]-4-iodobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.432g/cm3 |
|---|---|
| Boiling Point | 418.7ºC at 760mmHg |
| Molecular Formula | C13H19IN2O |
| Molecular Weight | 346.20700 |
| Flash Point | 207ºC |
| Exact Mass | 346.05400 |
| PSA | 32.34000 |
| LogP | 2.75370 |
| Vapour Pressure | 3.22E-07mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | HRVWCNMOEFNEON-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC(=O)c1ccc(I)cc1 |
| HS Code | 2924299090 |
|---|
|
~74%
N-(2-(diethylam... CAS#:106790-96-9 |
| Literature: Moreau; Parry; Michelot; et al. European Journal of Medicinal Chemistry, 1986 , vol. 21, # 5 p. 423 - 431 |
|
~%
N-(2-(diethylam... CAS#:106790-96-9 |
| Literature: Moreau; Parry; Michelot; et al. European Journal of Medicinal Chemistry, 1986 , vol. 21, # 5 p. 423 - 431 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (123I)Idab |
| Benzamide,N-(2-(diethylamino)ethyl)-4-iodo |
| N-Diethylamino-2 ethyl iodo-4-benzamide |
| N-(2-Diethylaminoethyl)-4-iodobenzamide |
| DEIB |
| I-BZA |