diethyl 2-(2,4-dichloro-5-fluoro-3-nitrobenzoyl)propanedioate structure
|
Common Name | diethyl 2-(2,4-dichloro-5-fluoro-3-nitrobenzoyl)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 106809-16-9 | Molecular Weight | 396.15200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12Cl2FNO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2-(2,4-dichloro-5-fluoro-3-nitrobenzoyl)propanedioate |
|---|
| Molecular Formula | C14H12Cl2FNO7 |
|---|---|
| Molecular Weight | 396.15200 |
| Exact Mass | 394.99700 |
| PSA | 115.49000 |
| LogP | 3.48900 |
| InChIKey | UMCIIIXCSXZJNZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)C(=O)c1cc(F)c(Cl)c([N+](=O)[O-])c1Cl |
|
~%
diethyl 2-(2,4-... CAS#:106809-16-9 |
| Literature: Engler, Michael; Ruesing, Guido; Soergel, Fritz; Holzgrabe, Ulrike Antimicrobial Agents and Chemotherapy, 1998 , vol. 42, # 5 p. 1151 - 1159 |
|
~%
diethyl 2-(2,4-... CAS#:106809-16-9 |
| Literature: Engler, Michael; Ruesing, Guido; Soergel, Fritz; Holzgrabe, Ulrike Antimicrobial Agents and Chemotherapy, 1998 , vol. 42, # 5 p. 1151 - 1159 |
|
~%
diethyl 2-(2,4-... CAS#:106809-16-9 |
| Literature: Engler, Michael; Ruesing, Guido; Soergel, Fritz; Holzgrabe, Ulrike Antimicrobial Agents and Chemotherapy, 1998 , vol. 42, # 5 p. 1151 - 1159 |
|
~%
diethyl 2-(2,4-... CAS#:106809-16-9 |
| Literature: Bayer Aktiengesellschaft Patent: US4870182 A1, 1989 ; |