5-(2,3-dichlorophenyl)furan-2-carbaldehyde structure
|
Common Name | 5-(2,3-dichlorophenyl)furan-2-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 106827-26-3 | Molecular Weight | 241.07000 | |
| Density | 1.392g/cm3 | Boiling Point | 366ºC at 760mmHg | |
| Molecular Formula | C11H6Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.1ºC | |
| Name | 5-(2,3-dichlorophenyl)furan-2-carbaldehyde |
|---|
| Density | 1.392g/cm3 |
|---|---|
| Boiling Point | 366ºC at 760mmHg |
| Molecular Formula | C11H6Cl2O2 |
| Molecular Weight | 241.07000 |
| Flash Point | 175.1ºC |
| Exact Mass | 239.97400 |
| PSA | 30.21000 |
| LogP | 4.06590 |
| Vapour Pressure | 1.51E-05mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | DFXHLUMKJNNXSE-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(-c2cccc(Cl)c2Cl)o1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2932190090 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |