Flusulfamide
Flusulfamide structure
|
Common Name | Flusulfamide | ||
|---|---|---|---|---|
| CAS Number | 106917-52-6 | Molecular Weight | 415.172 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 498.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C13H7Cl2F3N2O4S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 255.1±31.5 °C | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | flusulfamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 498.2±55.0 °C at 760 mmHg |
| Molecular Formula | C13H7Cl2F3N2O4S |
| Molecular Weight | 415.172 |
| Flash Point | 255.1±31.5 °C |
| Exact Mass | 413.945557 |
| PSA | 100.37000 |
| LogP | 5.73 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | GNVDAZSPJWCIQZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(NS(=O)(=O)c2ccc(Cl)c(C(F)(F)F)c2)c(Cl)c1 |
| Storage condition | 0-6°C |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H400 |
| Precautionary Statements | P273-P301 + P310 + P330-P391 |
| Hazard Codes | Xi |
| RIDADR | UN2811 - class 6.1 - PG 3 - EHS - Toxic solids, organic, n.o.s., HI: all |
| HS Code | 29350090 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Chloro-N-(2-chloro-4-nitrophenyl)-3-(trifluoromethyl)benzenesulfonamide |
| WNR CG DMSWR DG CXFFF |
| MTF 651 |
| 2',4-Dichloro-α,α,α-trifluoro-4'-nitro-m-toluenesulfonanilide |
| Flusulfamide |
| Nebijin |
| 2’,4-dichloro-α,α,α-trifluoro-4’-nitro-m-toluenesulfonanilide |
| Flusulfamide [ISO] |
| 4-chloro-N-(2-chloro-4-nitrophenyl)-3-(trifluoromethyl)benzene-1-sulfonamide |
| 4-Chloro-N-(2-chloro-4-nitrophenyl)-3-(trifluoromethyl)benzenesulphonamide |
| Benzenesulfonamide,4-chloro-N-(2-chloro-4-nitrophenyl)-3-(trifluoromethyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the storage conditions for flusulfamide? |
| A: Storage conditions for flusulfamide: 0-6°C. |
| Q: What is the LogP of flusulfamide? |
| A: LogP of flusulfamide is 5.73. |
| Q: What is the SMILES notation of flusulfamide? |
| A: SMILES notation of flusulfamide is O=[N+]([O-])c1ccc(NS(=O)(=O)c2ccc(Cl)c(C(F)(F)F)c2)c(Cl)c1. |
| Q: What is the InChIKey of flusulfamide? |
| A: InChIKey of flusulfamide is GNVDAZSPJWCIQZ-UHFFFAOYSA-N. |
| Q: What is the boiling point of flusulfamide? |
| A: Boiling point of flusulfamide is 498.2±55.0 °C at 760 mmHg. |
| Q: What is the molecular formula of flusulfamide? |
| A: Molecular formula of flusulfamide is C13H7Cl2F3N2O4S. |
| Q: What is the English name of flusulfamide? |
| A: The English name of flusulfamide is flusulfamide. |
| Q: What is the CAS number of flusulfamide? |
| A: CAS number of flusulfamide is 106917-52-6. |
| Q: What is the polar surface area (PSA) of flusulfamide? |
| A: Polar surface area (PSA) of flusulfamide is 100.37000. |
| Q: What is the molecular weight of flusulfamide? |
| A: Molecular weight of flusulfamide is 415.172. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |